About 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole
2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole (PubChem CID 67971570) has the molecular formula C18H17ClF2N4
and a molecular weight of 362.81 g/mol. Its IUPAC name is 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole.
Molecular Properties
| Compound Name | 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole |
| PubChem CID | 67971570 |
| Molecular Formula | C18H17ClF2N4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole |
| SMILES | Cn1c(-c2cc(N3CCC(F)(F)CC3)ncc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C18H17ClF2N4/c1-24-15-5-3-2-4-14(15)23-17(24)12-10-16(22-11-13(12)19)25-8-6-18(20,21)7-9-25/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | ZHIVJNJMMKUNLV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole?
The IUPAC name of 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole (CID 67971570) is 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole.
What is the SMILES notation for 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole?
The canonical SMILES for 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole is Cn1c(-c2cc(N3CCC(F)(F)CC3)ncc2Cl)nc2ccccc21.
What is the InChIKey of 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole?
The InChIKey is ZHIVJNJMMKUNLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClF2N4/c1-24-15-5-3-2-4-14(15)23-17(24)12-10-16(22-11-13(12)19)25-8-6-18(20,21)7-9-25/h2-5,10-11H,6-9H2,1H3.
What are the key properties of 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole?
2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole has a molecular weight of 362.81 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-chloro-2-(4,4-difluoropiperidin-1-yl)-4-pyridinyl]-1-methylbenzimidazole is sourced from PubChem (CID 67971570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).