C23H23ClFN3O5 — CID 67972553
(2R)-3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[(3-propyl-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoic acid (PubChem CID 67972553) has the molecular formula C23H23ClFN3O5 and a molecular weight of 475.90 g/mol. Its IUPAC name is (2R)-3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[(3-propyl-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoic acid.
| Compound Name | (2R)-3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[(3-propyl-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 67972553 |
| Molecular Formula | C23H23ClFN3O5 |
| Molecular Weight | 475.90 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (2R)-3-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl-[(3-propyl-1,2-oxazole-5-carbonyl)amino]amino]-2-hydroxypropanoic acid |
| SMILES | CCCc1cc(C(=O)NN(Cc2ccc(-c3cc(Cl)ccc3F)cc2)C[C@@H](O)C(=O)O)on1 |
| InChI | InChI=1S/C23H23ClFN3O5/c1-2-3-17-11-21(33-27-17)22(30)26-28(13-20(29)23(31)32)12-14-4-6-15(7-5-14)18-10-16(24)8-9-19(18)25/h4-11,20,29H,2-3,12-13H2,1H3,(H,26,30)(H,31,32)/t20-/m1/s1 |
| InChIKey | WULOXCJZNSCGSZ-HXUWFJFHSA-N |
| XLogP | 3.68 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|