C22H23Cl2N5O5 — CID 67972807
propan-2-yl (2R)-3-[[4-(2,5-dichlorophenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoate (PubChem CID 67972807) has the molecular formula C22H23Cl2N5O5 and a molecular weight of 508.36 g/mol. Its IUPAC name is propan-2-yl (2R)-3-[[4-(2,5-dichlorophenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoate.
| Compound Name | propan-2-yl (2R)-3-[[4-(2,5-dichlorophenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 67972807 |
| Molecular Formula | C22H23Cl2N5O5 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | propan-2-yl (2R)-3-[[4-(2,5-dichlorophenyl)phenyl]methyl-[(1-hydroxytriazole-4-carbonyl)amino]amino]-2-hydroxypropanoate |
| SMILES | CC(C)OC(=O)[C@H](O)CN(Cc1ccc(-c2cc(Cl)ccc2Cl)cc1)NC(=O)c1cn(O)nn1 |
| InChI | InChI=1S/C22H23Cl2N5O5/c1-13(2)34-22(32)20(30)12-28(26-21(31)19-11-29(33)27-25-19)10-14-3-5-15(6-4-14)17-9-16(23)7-8-18(17)24/h3-9,11,13,20,30,33H,10,12H2,1-2H3,(H,26,31)/t20-/m1/s1 |
| InChIKey | YMKCHODYJZZWCD-HXUWFJFHSA-N |
| XLogP | 2.95 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|