C34H40F3N3O5Si — CID 67973036
benzyl 3-[3-methoxy-4-[5-[4-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate (PubChem CID 67973036) has the molecular formula C34H40F3N3O5Si and a molecular weight of 655.79 g/mol. Its IUPAC name is benzyl 3-[3-methoxy-4-[5-[4-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate.
| Compound Name | benzyl 3-[3-methoxy-4-[5-[4-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67973036 |
| Molecular Formula | C34H40F3N3O5Si |
| Molecular Weight | 655.79 g/mol |
| Exact Mass | 655.27 |
| IUPAC Name | benzyl 3-[3-methoxy-4-[5-[4-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate |
| SMILES | COc1cc(OCC(C)(C)C(=O)OCc2ccccc2)ccc1-c1ccc(-c2nc(C(F)(F)F)c(COCC[Si](C)(C)C)[nH]2)cn1 |
| InChI | InChI=1S/C34H40F3N3O5Si/c1-33(2,32(41)44-20-23-10-8-7-9-11-23)22-45-25-13-14-26(29(18-25)42-3)27-15-12-24(19-38-27)31-39-28(30(40-31)34(35,36)37)21-43-16-17-46(4,5)6/h7-15,18-19H,16-17,20-22H2,1-6H3,(H,39,40) |
| InChIKey | SLCCRSXJZNDMGX-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.79 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|