C15H26N4+2 — CID 67973085
2,3,5-trimethyl-1-[3-(2,3,5-trimethylpyrazol-2-ium-1-yl)propyl]pyrazol-2-ium (PubChem CID 67973085) has the molecular formula C15H26N4+2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 2,3,5-trimethyl-1-[3-(2,3,5-trimethylpyrazol-2-ium-1-yl)propyl]pyrazol-2-ium.
| Compound Name | 2,3,5-trimethyl-1-[3-(2,3,5-trimethylpyrazol-2-ium-1-yl)propyl]pyrazol-2-ium |
|---|---|
| PubChem CID | 67973085 |
| Molecular Formula | C15H26N4+2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 2,3,5-trimethyl-1-[3-(2,3,5-trimethylpyrazol-2-ium-1-yl)propyl]pyrazol-2-ium |
| SMILES | Cc1cc(C)[n+](C)n1CCCn1c(C)cc(C)[n+]1C |
| InChI | InChI=1S/C15H26N4/c1-12-10-14(3)18(16(12)5)8-7-9-19-15(4)11-13(2)17(19)6/h10-11H,7-9H2,1-6H3/q+2 |
| InChIKey | UOEKZADJULUSEY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|