About 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one
5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one (PubChem CID 67973087) has the molecular formula C24H19NO2S
and a molecular weight of 385.49 g/mol. Its IUPAC name is 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one.
Molecular Properties
| Compound Name | 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one |
| PubChem CID | 67973087 |
| Molecular Formula | C24H19NO2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one |
| SMILES | O=c1cc(-c2ccc(O[C@@H]3CCc4c(-c5ccccc5)cccc43)cc2)s[nH]1 |
| InChI | InChI=1S/C24H19NO2S/c26-24-15-23(28-25-24)17-9-11-18(12-10-17)27-22-14-13-20-19(7-4-8-21(20)22)16-5-2-1-3-6-16/h1-12,15,22H,13-14H2,(H,25,26)/t22-/m1/s1 |
| InChIKey | HOVDOHHUOLFSBI-JOCHJYFZSA-N |
| XLogP | 5.84 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one?
The IUPAC name of 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one (CID 67973087) is 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one.
What is the SMILES notation for 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one?
The canonical SMILES for 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one is O=c1cc(-c2ccc(O[C@@H]3CCc4c(-c5ccccc5)cccc43)cc2)s[nH]1.
What is the InChIKey of 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one?
The InChIKey is HOVDOHHUOLFSBI-JOCHJYFZSA-N. The full InChI is InChI=1S/C24H19NO2S/c26-24-15-23(28-25-24)17-9-11-18(12-10-17)27-22-14-13-20-19(7-4-8-21(20)22)16-5-2-1-3-6-16/h1-12,15,22H,13-14H2,(H,25,26)/t22-/m1/s1.
What are the key properties of 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one?
5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one has a molecular weight of 385.49 g/mol, XLogP of 5.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[[(1R)-4-phenyl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one is sourced from PubChem (CID 67973087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).