About 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride
2,3,7-trimethyl-1H-indol-4-amine;hydrochloride (PubChem CID 67973093) has the molecular formula C11H15ClN2
and a molecular weight of 210.71 g/mol. Its IUPAC name is 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride |
| PubChem CID | 67973093 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride |
| SMILES | Cc1[nH]c2c(C)ccc(N)c2c1C.Cl |
| InChI | InChI=1S/C11H14N2.ClH/c1-6-4-5-9(12)10-7(2)8(3)13-11(6)10;/h4-5,13H,12H2,1-3H3;1H |
| InChIKey | XWQWLCSPPYWGGX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride?
The IUPAC name of 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride (CID 67973093) is 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride.
What is the SMILES notation for 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride?
The canonical SMILES for 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride is Cc1[nH]c2c(C)ccc(N)c2c1C.Cl.
What is the InChIKey of 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride?
The InChIKey is XWQWLCSPPYWGGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2.ClH/c1-6-4-5-9(12)10-7(2)8(3)13-11(6)10;/h4-5,13H,12H2,1-3H3;1H.
What are the key properties of 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride?
2,3,7-trimethyl-1H-indol-4-amine;hydrochloride has a molecular weight of 210.71 g/mol, XLogP of 3.10, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,7-trimethyl-1H-indol-4-amine;hydrochloride is sourced from PubChem (CID 67973093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).