C25H31F3N4O4Si — CID 67973324
2,2-dimethyl-3-[4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyridazin-3-yl]phenoxy]propanoic acid (PubChem CID 67973324) has the molecular formula C25H31F3N4O4Si and a molecular weight of 536.63 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyridazin-3-yl]phenoxy]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyridazin-3-yl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 67973324 |
| Molecular Formula | C25H31F3N4O4Si |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 2,2-dimethyl-3-[4-[6-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyridazin-3-yl]phenoxy]propanoic acid |
| SMILES | CC(C)(COc1ccc(-c2ccc(-c3nc(C(F)(F)F)cn3COCC[Si](C)(C)C)nn2)cc1)C(=O)O |
| InChI | InChI=1S/C25H31F3N4O4Si/c1-24(2,23(33)34)15-36-18-8-6-17(7-9-18)19-10-11-20(31-30-19)22-29-21(25(26,27)28)14-32(22)16-35-12-13-37(3,4)5/h6-11,14H,12-13,15-16H2,1-5H3,(H,33,34) |
| InChIKey | AAFNCTRXGSRUQQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|