C26H32F3N3O4Si — CID 67973331
2,2-dimethyl-3-[[5-[4-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]-2-pyridinyl]oxy]propanoic acid (PubChem CID 67973331) has the molecular formula C26H32F3N3O4Si and a molecular weight of 535.64 g/mol. Its IUPAC name is 2,2-dimethyl-3-[[5-[4-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]-2-pyridinyl]oxy]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[[5-[4-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]-2-pyridinyl]oxy]propanoic acid |
|---|---|
| PubChem CID | 67973331 |
| Molecular Formula | C26H32F3N3O4Si |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 2,2-dimethyl-3-[[5-[4-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]-2-pyridinyl]oxy]propanoic acid |
| SMILES | CC(C)(COc1ccc(-c2ccc(-c3nc(C(F)(F)F)cn3COCC[Si](C)(C)C)cc2)cn1)C(=O)O |
| InChI | InChI=1S/C26H32F3N3O4Si/c1-25(2,24(33)34)16-36-22-11-10-20(14-30-22)18-6-8-19(9-7-18)23-31-21(26(27,28)29)15-32(23)17-35-12-13-37(3,4)5/h6-11,14-15H,12-13,16-17H2,1-5H3,(H,33,34) |
| InChIKey | FFKPVGNRBXOWJS-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|