About 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine
7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine (PubChem CID 67973558) has the molecular formula C27H38N4O2
and a molecular weight of 450.63 g/mol. Its IUPAC name is 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine.
Molecular Properties
| Compound Name | 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine |
| PubChem CID | 67973558 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine |
| SMILES | CCOc1ccc(N)c2c(CC)c(C)[nH]c12.CCOc1ccc(N)c2c(CC)c(C)n(C)c12 |
| InChI | InChI=1S/C14H20N2O.C13H18N2O/c1-5-10-9(3)16(4)14-12(17-6-2)8-7-11(15)13(10)14;1-4-9-8(3)15-13-11(16-5-2)7-6-10(14)12(9)13/h7-8H,5-6,15H2,1-4H3;6-7,15H,4-5,14H2,1-3H3 |
| InChIKey | JWRQBMZOGVVDTO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine?
The IUPAC name of 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine (CID 67973558) is 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine.
What is the SMILES notation for 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine?
The canonical SMILES for 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine is CCOc1ccc(N)c2c(CC)c(C)[nH]c12.CCOc1ccc(N)c2c(CC)c(C)n(C)c12.
What is the InChIKey of 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine?
The InChIKey is JWRQBMZOGVVDTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O.C13H18N2O/c1-5-10-9(3)16(4)14-12(17-6-2)8-7-11(15)13(10)14;1-4-9-8(3)15-13-11(16-5-2)7-6-10(14)12(9)13/h7-8H,5-6,15H2,1-4H3;6-7,15H,4-5,14H2,1-3H3.
What are the key properties of 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine?
7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine has a molecular weight of 450.63 g/mol, XLogP of 6.05, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-3-ethyl-1,2-dimethylindol-4-amine;7-ethoxy-3-ethyl-2-methyl-1H-indol-4-amine is sourced from PubChem (CID 67973558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).