C25H31F3N4O4Si — CID 67973580
2,2-dimethyl-3-[[5-[5-[4-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]-2-pyridinyl]-2-pyridinyl]oxy]propanoic acid (PubChem CID 67973580) has the molecular formula C25H31F3N4O4Si and a molecular weight of 536.63 g/mol. Its IUPAC name is 2,2-dimethyl-3-[[5-[5-[4-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]-2-pyridinyl]-2-pyridinyl]oxy]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[[5-[5-[4-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]-2-pyridinyl]-2-pyridinyl]oxy]propanoic acid |
|---|---|
| PubChem CID | 67973580 |
| Molecular Formula | C25H31F3N4O4Si |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 2,2-dimethyl-3-[[5-[5-[4-(trifluoromethyl)-5-(2-trimethylsilylethoxymethyl)-1H-imidazol-2-yl]-2-pyridinyl]-2-pyridinyl]oxy]propanoic acid |
| SMILES | CC(C)(COc1ccc(-c2ccc(-c3nc(C(F)(F)F)c(COCC[Si](C)(C)C)[nH]3)cn2)cn1)C(=O)O |
| InChI | InChI=1S/C25H31F3N4O4Si/c1-24(2,23(33)34)15-36-20-9-7-16(12-30-20)18-8-6-17(13-29-18)22-31-19(21(32-22)25(26,27)28)14-35-10-11-37(3,4)5/h6-9,12-13H,10-11,14-15H2,1-5H3,(H,31,32)(H,33,34) |
| InChIKey | MKOLQCUGOPFBTG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|