C22H26ClF3N8O4 — CID 67973702
1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 67973702) has the molecular formula C22H26ClF3N8O4 and a molecular weight of 558.95 g/mol. Its IUPAC name is 1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 67973702 |
| Molecular Formula | C22H26ClF3N8O4 |
| Molecular Weight | 558.95 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | CN(CCCNC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H26ClF3N8O4/c1-33(6-2-5-28-21(37)32-11-3-4-13(23)12(7-11)22(24,25)26)8-14-16(35)17(36)20(38-14)34-10-31-15-18(27)29-9-30-19(15)34/h3-4,7,9-10,14,16-17,20,35-36H,2,5-6,8H2,1H3,(H2,27,29,30)(H2,28,32,37)/t14-,16+,17-,20-/m1/s1 |
| InChIKey | UVFNUIIMJIRTEI-XNWPKKHHSA-N |
| XLogP | 1.84 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.95 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|