C25H32N4O4 — CID 67973810
2-(4-amino-2,3-dimethyl-1H-indol-7-yl)-2-(4-amino-1,2,3-trimethylindol-7-yl)oxy-1-(2-hydroxyethoxy)ethanol (PubChem CID 67973810) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-(4-amino-2,3-dimethyl-1H-indol-7-yl)-2-(4-amino-1,2,3-trimethylindol-7-yl)oxy-1-(2-hydroxyethoxy)ethanol.
| Compound Name | 2-(4-amino-2,3-dimethyl-1H-indol-7-yl)-2-(4-amino-1,2,3-trimethylindol-7-yl)oxy-1-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 67973810 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 2-(4-amino-2,3-dimethyl-1H-indol-7-yl)-2-(4-amino-1,2,3-trimethylindol-7-yl)oxy-1-(2-hydroxyethoxy)ethanol |
| SMILES | Cc1[nH]c2c(C(Oc3ccc(N)c4c(C)c(C)n(C)c34)C(O)OCCO)ccc(N)c2c1C |
| InChI | InChI=1S/C25H32N4O4/c1-12-14(3)28-22-16(6-7-17(26)20(12)22)24(25(31)32-11-10-30)33-19-9-8-18(27)21-13(2)15(4)29(5)23(19)21/h6-9,24-25,28,30-31H,10-11,26-27H2,1-5H3 |
| InChIKey | POGXWXYGPCXSLI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|