C24H30ClF3N8O4 — CID 67973948
1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 67973948) has the molecular formula C24H30ClF3N8O4 and a molecular weight of 587.00 g/mol. Its IUPAC name is 1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 67973948 |
| Molecular Formula | C24H30ClF3N8O4 |
| Molecular Weight | 587.00 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | 1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)N(CCCNC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H30ClF3N8O4/c1-12(2)35(7-3-6-30-23(39)34-13-4-5-15(25)14(8-13)24(26,27)28)9-16-18(37)19(38)22(40-16)36-11-33-17-20(29)31-10-32-21(17)36/h4-5,8,10-12,16,18-19,22,37-38H,3,6-7,9H2,1-2H3,(H2,29,31,32)(H2,30,34,39)/t16-,18+,19-,22-/m1/s1 |
| InChIKey | RDMLGKQXICTISP-ITBLURSFSA-N |
| XLogP | 2.62 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.00 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|