C30H32N2O6 — CID 67974050
N-[(2S,3S,4R,5R,6R)-2,5-dihydroxy-6-[[(4-methylbenzoyl)amino]methyl]-4-prop-1-enoxyoxan-3-yl]-3-phenylbenzamide (PubChem CID 67974050) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is N-[(2S,3S,4R,5R,6R)-2,5-dihydroxy-6-[[(4-methylbenzoyl)amino]methyl]-4-prop-1-enoxyoxan-3-yl]-3-phenylbenzamide.
| Compound Name | N-[(2S,3S,4R,5R,6R)-2,5-dihydroxy-6-[[(4-methylbenzoyl)amino]methyl]-4-prop-1-enoxyoxan-3-yl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 67974050 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | N-[(2S,3S,4R,5R,6R)-2,5-dihydroxy-6-[[(4-methylbenzoyl)amino]methyl]-4-prop-1-enoxyoxan-3-yl]-3-phenylbenzamide |
| SMILES | CC=CO[C@H]1[C@H](O)[C@@H](CNC(=O)c2ccc(C)cc2)O[C@H](O)[C@H]1NC(=O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C30H32N2O6/c1-3-16-37-27-25(32-29(35)23-11-7-10-22(17-23)20-8-5-4-6-9-20)30(36)38-24(26(27)33)18-31-28(34)21-14-12-19(2)13-15-21/h3-17,24-27,30,33,36H,18H2,1-2H3,(H,31,34)(H,32,35)/t24-,25+,26-,27-,30+/m1/s1 |
| InChIKey | FANUGCRWYDAHEA-CQWIBWTOSA-N |
| XLogP | 3.19 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|