C20H17FN2O2 — CID 67974850
N-[7-(4-fluoro-5-hydroxy-2-methylphenyl)isoquinolin-3-yl]cyclopropanecarboxamide (PubChem CID 67974850) has the molecular formula C20H17FN2O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is N-[7-(4-fluoro-5-hydroxy-2-methylphenyl)isoquinolin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[7-(4-fluoro-5-hydroxy-2-methylphenyl)isoquinolin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 67974850 |
| Molecular Formula | C20H17FN2O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[7-(4-fluoro-5-hydroxy-2-methylphenyl)isoquinolin-3-yl]cyclopropanecarboxamide |
| SMILES | Cc1cc(F)c(O)cc1-c1ccc2cc(NC(=O)C3CC3)ncc2c1 |
| InChI | InChI=1S/C20H17FN2O2/c1-11-6-17(21)18(24)9-16(11)14-5-4-13-8-19(22-10-15(13)7-14)23-20(25)12-2-3-12/h4-10,12,24H,2-3H2,1H3,(H,22,23,25) |
| InChIKey | OPPDTNXAPSWOGR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |