C8H17Cl2N2O3P — CID 67974999
N,3-bis(2-chloroethyl)-4-methoxy-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine (PubChem CID 67974999) has the molecular formula C8H17Cl2N2O3P and a molecular weight of 291.12 g/mol. Its IUPAC name is N,3-bis(2-chloroethyl)-4-methoxy-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
| Compound Name | N,3-bis(2-chloroethyl)-4-methoxy-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
|---|---|
| PubChem CID | 67974999 |
| Molecular Formula | C8H17Cl2N2O3P |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | N,3-bis(2-chloroethyl)-4-methoxy-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
| SMILES | COC1CCOP(=O)(NCCCl)N1CCCl |
| InChI | InChI=1S/C8H17Cl2N2O3P/c1-14-8-2-7-15-16(13,11-5-3-9)12(8)6-4-10/h8H,2-7H2,1H3,(H,11,13) |
| InChIKey | RWTBNEHVKWJYTK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|