About 4-oxo-2,3-dihydropyridine-1-carboxylic acid
4-oxo-2,3-dihydropyridine-1-carboxylic acid (PubChem CID 67975094) has the molecular formula C6H7NO3
and a molecular weight of 141.13 g/mol. Its IUPAC name is 4-oxo-2,3-dihydropyridine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-oxo-2,3-dihydropyridine-1-carboxylic acid |
| PubChem CID | 67975094 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 4-oxo-2,3-dihydropyridine-1-carboxylic acid |
| SMILES | O=C1C=CN(C(=O)O)CC1 |
| InChI | InChI=1S/C6H7NO3/c8-5-1-3-7(4-2-5)6(9)10/h1,3H,2,4H2,(H,9,10) |
| InChIKey | AAMOFFGTRVTWMM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-oxo-2,3-dihydropyridine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-2,3-dihydropyridine-1-carboxylic acid?
The IUPAC name of 4-oxo-2,3-dihydropyridine-1-carboxylic acid (CID 67975094) is 4-oxo-2,3-dihydropyridine-1-carboxylic acid.
What is the SMILES notation for 4-oxo-2,3-dihydropyridine-1-carboxylic acid?
The canonical SMILES for 4-oxo-2,3-dihydropyridine-1-carboxylic acid is O=C1C=CN(C(=O)O)CC1.
What is the InChIKey of 4-oxo-2,3-dihydropyridine-1-carboxylic acid?
The InChIKey is AAMOFFGTRVTWMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c8-5-1-3-7(4-2-5)6(9)10/h1,3H,2,4H2,(H,9,10).
What are the key properties of 4-oxo-2,3-dihydropyridine-1-carboxylic acid?
4-oxo-2,3-dihydropyridine-1-carboxylic acid has a molecular weight of 141.13 g/mol, XLogP of 0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2,3-dihydropyridine-1-carboxylic acid is sourced from PubChem (CID 67975094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).