About methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate
methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate (PubChem CID 67975301) has the molecular formula C24H27N3O3
and a molecular weight of 405.50 g/mol. Its IUPAC name is methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate |
| PubChem CID | 67975301 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)COc1ccc(-c2ccc(-c3ncc(C4CCC4)[nH]3)cn2)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-24(2,23(28)29-3)15-30-19-10-7-17(8-11-19)20-12-9-18(13-25-20)22-26-14-21(27-22)16-5-4-6-16/h7-14,16H,4-6,15H2,1-3H3,(H,26,27) |
| InChIKey | LQOVNSYCTAVJRM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate?
The IUPAC name of methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate (CID 67975301) is methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate.
What is the SMILES notation for methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate?
The canonical SMILES for methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate is COC(=O)C(C)(C)COc1ccc(-c2ccc(-c3ncc(C4CCC4)[nH]3)cn2)cc1.
What is the InChIKey of methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate?
The InChIKey is LQOVNSYCTAVJRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O3/c1-24(2,23(28)29-3)15-30-19-10-7-17(8-11-19)20-12-9-18(13-25-20)22-26-14-21(27-22)16-5-4-6-16/h7-14,16H,4-6,15H2,1-3H3,(H,26,27).
What are the key properties of methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate?
methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate has a molecular weight of 405.50 g/mol, XLogP of 4.98, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-[5-(5-cyclobutyl-1H-imidazol-2-yl)-2-pyridinyl]phenoxy]-2,2-dimethylpropanoate is sourced from PubChem (CID 67975301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).