C19H25NO — CID 67975331
N,N-dimethylbutan-1-amine;9H-fluoren-1-ol (PubChem CID 67975331) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is N,N-dimethylbutan-1-amine;9H-fluoren-1-ol.
| Compound Name | N,N-dimethylbutan-1-amine;9H-fluoren-1-ol |
|---|---|
| PubChem CID | 67975331 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | N,N-dimethylbutan-1-amine;9H-fluoren-1-ol |
| SMILES | CCCCN(C)C.Oc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10O.C6H15N/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13;1-4-5-6-7(2)3/h1-7,14H,8H2;4-6H2,1-3H3 |
| InChIKey | RIYRNQBGSNKZML-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |