C37H29FN4O2 — CID 67975472
ethyl 8-(4-fluorophenyl)-1-trityl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate (PubChem CID 67975472) has the molecular formula C37H29FN4O2 and a molecular weight of 580.66 g/mol. Its IUPAC name is ethyl 8-(4-fluorophenyl)-1-trityl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate.
| Compound Name | ethyl 8-(4-fluorophenyl)-1-trityl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate |
|---|---|
| PubChem CID | 67975472 |
| Molecular Formula | C37H29FN4O2 |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | ethyl 8-(4-fluorophenyl)-1-trityl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate |
| SMILES | CCOC(=O)c1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2c1CCc1cnc(-c3ccc(F)cc3)nc1-2 |
| InChI | InChI=1S/C37H29FN4O2/c1-2-44-36(43)33-31-23-20-26-24-39-35(25-18-21-30(38)22-19-25)40-32(26)34(31)42(41-33)37(27-12-6-3-7-13-27,28-14-8-4-9-15-28)29-16-10-5-11-17-29/h3-19,21-22,24H,2,20,23H2,1H3 |
| InChIKey | BHDQABOIKBOGJL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|