C11H11NO — CID 67975699
3,3a,4,4a-tetrahydro-1H-indeno[1,2-b]pyrrol-2-one (PubChem CID 67975699) has the molecular formula C11H11NO and a molecular weight of 173.22 g/mol. Its IUPAC name is 3,3a,4,4a-tetrahydro-1H-indeno[1,2-b]pyrrol-2-one.
| Compound Name | 3,3a,4,4a-tetrahydro-1H-indeno[1,2-b]pyrrol-2-one |
|---|---|
| PubChem CID | 67975699 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3,3a,4,4a-tetrahydro-1H-indeno[1,2-b]pyrrol-2-one |
| SMILES | O=C1CC2CC3C=CC=CC3=C2N1 |
| InChI | InChI=1S/C11H11NO/c13-10-6-8-5-7-3-1-2-4-9(7)11(8)12-10/h1-4,7-8H,5-6H2,(H,12,13) |
| InChIKey | BLEBUEYGAITOAF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |