C31H29BFN3O2 — CID 67975717
5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazolo[5,4-b]pyridine (PubChem CID 67975717) has the molecular formula C31H29BFN3O2 and a molecular weight of 505.40 g/mol. Its IUPAC name is 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazolo[5,4-b]pyridine.
| Compound Name | 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 67975717 |
| Molecular Formula | C31H29BFN3O2 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazolo[5,4-b]pyridine |
| SMILES | CC1(C)OB(c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ncc(F)cc23)OC1(C)C |
| InChI | InChI=1S/C31H29BFN3O2/c1-29(2)30(3,4)38-32(37-29)27-26-20-25(33)21-34-28(26)36(35-27)31(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-21H,1-4H3 |
| InChIKey | UGPRKYAMNVLJEL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|