C17H23N3O3Si — CID 67976041
2-(phenoxymethyl)-6-(trimethylsilyloxymethyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 67976041) has the molecular formula C17H23N3O3Si and a molecular weight of 345.48 g/mol. Its IUPAC name is 2-(phenoxymethyl)-6-(trimethylsilyloxymethyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 2-(phenoxymethyl)-6-(trimethylsilyloxymethyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 67976041 |
| Molecular Formula | C17H23N3O3Si |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-(phenoxymethyl)-6-(trimethylsilyloxymethyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | C[Si](C)(C)OCC1Cn2nc(COc3ccccc3)cc2C(=O)N1 |
| InChI | InChI=1S/C17H23N3O3Si/c1-24(2,3)23-12-14-10-20-16(17(21)18-14)9-13(19-20)11-22-15-7-5-4-6-8-15/h4-9,14H,10-12H2,1-3H3,(H,18,21) |
| InChIKey | KEKIUVBOOHIGDJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|