C24H28N6O3 — CID 67976330
7-(2-methoxyethoxy)-N-[1-(piperidin-4-ylmethyl)indazol-4-yl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 67976330) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 7-(2-methoxyethoxy)-N-[1-(piperidin-4-ylmethyl)indazol-4-yl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 7-(2-methoxyethoxy)-N-[1-(piperidin-4-ylmethyl)indazol-4-yl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67976330 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 7-(2-methoxyethoxy)-N-[1-(piperidin-4-ylmethyl)indazol-4-yl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | COCCOc1ccn2c(C(=O)Nc3cccc4c3cnn4CC3CCNCC3)cnc2c1 |
| InChI | InChI=1S/C24H28N6O3/c1-32-11-12-33-18-7-10-29-22(15-26-23(29)13-18)24(31)28-20-3-2-4-21-19(20)14-27-30(21)16-17-5-8-25-9-6-17/h2-4,7,10,13-15,17,25H,5-6,8-9,11-12,16H2,1H3,(H,28,31) |
| InChIKey | BPMBQTKGXIXEIS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|