C8H13F3N2O — CID 67976487
4,5-dimethyl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one (PubChem CID 67976487) has the molecular formula C8H13F3N2O and a molecular weight of 210.20 g/mol. Its IUPAC name is 4,5-dimethyl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one.
| Compound Name | 4,5-dimethyl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 67976487 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 4,5-dimethyl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one |
| SMILES | CC1CN(CC(F)(F)F)C(=O)NC1C |
| InChI | InChI=1S/C8H13F3N2O/c1-5-3-13(4-8(9,10)11)7(14)12-6(5)2/h5-6H,3-4H2,1-2H3,(H,12,14) |
| InChIKey | HHFBUCLRGSBUGI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |