About 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole
5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole (PubChem CID 67977252) has the molecular formula C12H14ClNS
and a molecular weight of 239.77 g/mol. Its IUPAC name is 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole |
| PubChem CID | 67977252 |
| Molecular Formula | C12H14ClNS |
| Molecular Weight | 239.77 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole |
| SMILES | C=CCCCN1CSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H14ClNS/c1-2-3-4-7-14-9-15-12-6-5-10(13)8-11(12)14/h2,5-6,8H,1,3-4,7,9H2 |
| InChIKey | LVYYSVNOJAMYRJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole?
The IUPAC name of 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole (CID 67977252) is 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole.
What is the SMILES notation for 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole?
The canonical SMILES for 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole is C=CCCCN1CSc2ccc(Cl)cc21.
What is the InChIKey of 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole?
The InChIKey is LVYYSVNOJAMYRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNS/c1-2-3-4-7-14-9-15-12-6-5-10(13)8-11(12)14/h2,5-6,8H,1,3-4,7,9H2.
What are the key properties of 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole?
5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole has a molecular weight of 239.77 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-pent-4-enyl-2H-1,3-benzothiazole is sourced from PubChem (CID 67977252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).