About N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine
N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine (PubChem CID 67977713) has the molecular formula C23H23N5
and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine |
| PubChem CID | 67977713 |
| Molecular Formula | C23H23N5 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1cncc(-c2ccc3[nH]nc(N4Cc5ccccc5C4)c3c2)c1 |
| InChI | InChI=1S/C23H23N5/c1-2-24-11-16-9-20(13-25-12-16)17-7-8-22-21(10-17)23(27-26-22)28-14-18-5-3-4-6-19(18)15-28/h3-10,12-13,24H,2,11,14-15H2,1H3,(H,26,27) |
| InChIKey | JWWXTVBLMMOTQR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine?
The IUPAC name of N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine (CID 67977713) is N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine.
What is the SMILES notation for N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine?
The canonical SMILES for N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine is CCNCc1cncc(-c2ccc3[nH]nc(N4Cc5ccccc5C4)c3c2)c1.
What is the InChIKey of N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine?
The InChIKey is JWWXTVBLMMOTQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N5/c1-2-24-11-16-9-20(13-25-12-16)17-7-8-22-21(10-17)23(27-26-22)28-14-18-5-3-4-6-19(18)15-28/h3-10,12-13,24H,2,11,14-15H2,1H3,(H,26,27).
What are the key properties of N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine?
N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine has a molecular weight of 369.47 g/mol, XLogP of 4.25, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-[3-(1,3-dihydroisoindol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]methyl]ethanamine is sourced from PubChem (CID 67977713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).