About 1,4,5-tripentyltriazole
1,4,5-tripentyltriazole (PubChem CID 67977716) has the molecular formula C17H33N3
and a molecular weight of 279.47 g/mol. Its IUPAC name is 1,4,5-tripentyltriazole.
Molecular Properties
| Compound Name | 1,4,5-tripentyltriazole |
| PubChem CID | 67977716 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 1,4,5-tripentyltriazole |
| SMILES | CCCCCc1nnn(CCCCC)c1CCCCC |
| InChI | InChI=1S/C17H33N3/c1-4-7-10-13-16-17(14-11-8-5-2)20(19-18-16)15-12-9-6-3/h4-15H2,1-3H3 |
| InChIKey | NFAVULFRIBREEH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4,5-tripentyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,5-tripentyltriazole?
The IUPAC name of 1,4,5-tripentyltriazole (CID 67977716) is 1,4,5-tripentyltriazole.
What is the SMILES notation for 1,4,5-tripentyltriazole?
The canonical SMILES for 1,4,5-tripentyltriazole is CCCCCc1nnn(CCCCC)c1CCCCC.
What is the InChIKey of 1,4,5-tripentyltriazole?
The InChIKey is NFAVULFRIBREEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N3/c1-4-7-10-13-16-17(14-11-8-5-2)20(19-18-16)15-12-9-6-3/h4-15H2,1-3H3.
What are the key properties of 1,4,5-tripentyltriazole?
1,4,5-tripentyltriazole has a molecular weight of 279.47 g/mol, XLogP of 4.93, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,5-tripentyltriazole is sourced from PubChem (CID 67977716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).