C22H28F4N6 — CID 67977921
(3S,5R)-2-(2,5-difluorophenyl)-1-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)piperidin-3-amine (PubChem CID 67977921) has the molecular formula C22H28F4N6 and a molecular weight of 452.50 g/mol. Its IUPAC name is (3S,5R)-2-(2,5-difluorophenyl)-1-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)piperidin-3-amine.
| Compound Name | (3S,5R)-2-(2,5-difluorophenyl)-1-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 67977921 |
| Molecular Formula | C22H28F4N6 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | (3S,5R)-2-(2,5-difluorophenyl)-1-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)piperidin-3-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3cn[nH]c3C2)CN(CCN2CCC(F)(F)C2)C1c1cc(F)ccc1F |
| InChI | InChI=1S/C22H28F4N6/c23-15-1-2-18(24)17(7-15)21-19(27)8-16(32-10-14-9-28-29-20(14)12-32)11-31(21)6-5-30-4-3-22(25,26)13-30/h1-2,7,9,16,19,21H,3-6,8,10-13,27H2,(H,28,29)/t16-,19+,21?/m1/s1 |
| InChIKey | SFEUWQNDRJGEOY-NTEFNCDNSA-N |
| XLogP | 2.49 |
| TPSA | 64.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |