About 4-methyl-3-methylidene-1,4-thiazepane
4-methyl-3-methylidene-1,4-thiazepane (PubChem CID 67978395) has the molecular formula C7H13NS
and a molecular weight of 143.25 g/mol. Its IUPAC name is 4-methyl-3-methylidene-1,4-thiazepane.
Molecular Properties
| Compound Name | 4-methyl-3-methylidene-1,4-thiazepane |
| PubChem CID | 67978395 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 4-methyl-3-methylidene-1,4-thiazepane |
| SMILES | C=C1CSCCCN1C |
| InChI | InChI=1S/C7H13NS/c1-7-6-9-5-3-4-8(7)2/h1,3-6H2,2H3 |
| InChIKey | IIVIVZLULLKMRK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-3-methylidene-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-methylidene-1,4-thiazepane?
The IUPAC name of 4-methyl-3-methylidene-1,4-thiazepane (CID 67978395) is 4-methyl-3-methylidene-1,4-thiazepane.
What is the SMILES notation for 4-methyl-3-methylidene-1,4-thiazepane?
The canonical SMILES for 4-methyl-3-methylidene-1,4-thiazepane is C=C1CSCCCN1C.
What is the InChIKey of 4-methyl-3-methylidene-1,4-thiazepane?
The InChIKey is IIVIVZLULLKMRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NS/c1-7-6-9-5-3-4-8(7)2/h1,3-6H2,2H3.
What are the key properties of 4-methyl-3-methylidene-1,4-thiazepane?
4-methyl-3-methylidene-1,4-thiazepane has a molecular weight of 143.25 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-methylidene-1,4-thiazepane is sourced from PubChem (CID 67978395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).