About 1-methyl-6-methylidene-2,5-dihydropyridine
1-methyl-6-methylidene-2,5-dihydropyridine (PubChem CID 67978398) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is 1-methyl-6-methylidene-2,5-dihydropyridine.
Molecular Properties
| Compound Name | 1-methyl-6-methylidene-2,5-dihydropyridine |
| PubChem CID | 67978398 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 1-methyl-6-methylidene-2,5-dihydropyridine |
| SMILES | C=C1CC=CCN1C |
| InChI | InChI=1S/C7H11N/c1-7-5-3-4-6-8(7)2/h3-4H,1,5-6H2,2H3 |
| InChIKey | PCDQXKIQSYQPRS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-6-methylidene-2,5-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-methylidene-2,5-dihydropyridine?
The IUPAC name of 1-methyl-6-methylidene-2,5-dihydropyridine (CID 67978398) is 1-methyl-6-methylidene-2,5-dihydropyridine.
What is the SMILES notation for 1-methyl-6-methylidene-2,5-dihydropyridine?
The canonical SMILES for 1-methyl-6-methylidene-2,5-dihydropyridine is C=C1CC=CCN1C.
What is the InChIKey of 1-methyl-6-methylidene-2,5-dihydropyridine?
The InChIKey is PCDQXKIQSYQPRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N/c1-7-5-3-4-6-8(7)2/h3-4H,1,5-6H2,2H3.
What are the key properties of 1-methyl-6-methylidene-2,5-dihydropyridine?
1-methyl-6-methylidene-2,5-dihydropyridine has a molecular weight of 109.17 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-methylidene-2,5-dihydropyridine is sourced from PubChem (CID 67978398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).