C18H26O5 — CID 67978652
tert-butyl [4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl] carbonate (PubChem CID 67978652) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is tert-butyl [4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl] carbonate.
| Compound Name | tert-butyl [4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl] carbonate |
|---|---|
| PubChem CID | 67978652 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | tert-butyl [4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(C2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C18H26O5/c1-16(2,3)23-15(19)20-13-10-8-12(9-11-13)14-21-17(4,5)18(6,7)22-14/h8-11,14H,1-7H3 |
| InChIKey | LWYUZQWKOATKDM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|