C30H28N4O3 — CID 67978709
(3R)-5-methoxy-2'-[3-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]-1H-indazol-6-yl]spiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 67978709) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is (3R)-5-methoxy-2'-[3-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]-1H-indazol-6-yl]spiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | (3R)-5-methoxy-2'-[3-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]-1H-indazol-6-yl]spiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 67978709 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (3R)-5-methoxy-2'-[3-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]-1H-indazol-6-yl]spiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | COc1ccc2c(c1)[C@]1(CC1c1ccc3c(/C=C/c4ccc(N5CCOCC5)cc4)n[nH]c3c1)C(=O)N2 |
| InChI | InChI=1S/C30H28N4O3/c1-36-22-8-11-27-24(17-22)30(29(35)31-27)18-25(30)20-5-9-23-26(32-33-28(23)16-20)10-4-19-2-6-21(7-3-19)34-12-14-37-15-13-34/h2-11,16-17,25H,12-15,18H2,1H3,(H,31,35)(H,32,33)/b10-4+/t25?,30-/m0/s1 |
| InChIKey | UGMSODRRQLUOOB-BGAUFJOBSA-N |
| XLogP | 4.96 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|