C18H26N2O — CID 67978933
(17S)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-ol (PubChem CID 67978933) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (17S)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-ol.
| Compound Name | (17S)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-ol |
|---|---|
| PubChem CID | 67978933 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (17S)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-ol |
| SMILES | O[C@H]1CCC2C3CCC4Cc5[nH]ncc5CC4C3CCC21 |
| InChI | InChI=1S/C18H26N2O/c21-18-6-5-13-12-2-1-10-8-17-11(9-19-20-17)7-16(10)14(12)3-4-15(13)18/h9-10,12-16,18,21H,1-8H2,(H,19,20)/t10?,12?,13?,14?,15?,16?,18-/m0/s1 |
| InChIKey | KCFABGQHLGKLBV-NCGIIZSPSA-N |
| XLogP | 2.95 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |