About US8865911, 92 Isomer 1
US8865911, 92 Isomer 1 (PubChem CID 67979436) has the molecular formula C26H28N4O2
and a molecular weight of 428.54 g/mol.
Molecular Properties
| Compound Name | US8865911, 92 Isomer 1 |
| PubChem CID | 67979436 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | — |
| SMILES | COc1cc(C#N)cc(-c2ccc3c(c2)[C@@]2(N=C(C)C(N)=N2)C2(CCC(OC)CC2)C3)c1 |
| InChI | InChI=1S/C26H28N4O2/c1-16-24(28)30-26(29-16)23-13-18(20-10-17(15-27)11-22(12-20)32-3)4-5-19(23)14-25(26)8-6-21(31-2)7-9-25/h4-5,10-13,21H,6-9,14H2,1-3H3,(H2,28,30)/t21?,25?,26-/m0/s1 |
| InChIKey | SKNSXIIPICYXKY-FNEQHPHYSA-N |
| XLogP | 4.35 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze US8865911, 92 Isomer 1 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US8865911, 92 Isomer 1?
The IUPAC name of US8865911, 92 Isomer 1 (CID 67979436) is not available.
What is the SMILES notation for US8865911, 92 Isomer 1?
The canonical SMILES for US8865911, 92 Isomer 1 is COc1cc(C#N)cc(-c2ccc3c(c2)[C@@]2(N=C(C)C(N)=N2)C2(CCC(OC)CC2)C3)c1.
What is the InChIKey of US8865911, 92 Isomer 1?
The InChIKey is SKNSXIIPICYXKY-FNEQHPHYSA-N. The full InChI is InChI=1S/C26H28N4O2/c1-16-24(28)30-26(29-16)23-13-18(20-10-17(15-27)11-22(12-20)32-3)4-5-19(23)14-25(26)8-6-21(31-2)7-9-25/h4-5,10-13,21H,6-9,14H2,1-3H3,(H2,28,30)/t21?,25?,26-/m0/s1.
What are the key properties of US8865911, 92 Isomer 1?
US8865911, 92 Isomer 1 has a molecular weight of 428.54 g/mol, XLogP of 4.35, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for US8865911, 92 Isomer 1 is sourced from PubChem (CID 67979436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).