About 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one
6-(3-fluoropropoxy)-2,3-dihydroinden-1-one (PubChem CID 67979471) has the molecular formula C12H13FO2
and a molecular weight of 208.23 g/mol. Its IUPAC name is 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one |
| PubChem CID | 67979471 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2ccc(OCCCF)cc21 |
| InChI | InChI=1S/C12H13FO2/c13-6-1-7-15-10-4-2-9-3-5-12(14)11(9)8-10/h2,4,8H,1,3,5-7H2 |
| InChIKey | HAHGCXCELXOBDW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one?
The IUPAC name of 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one (CID 67979471) is 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one.
What is the SMILES notation for 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one?
The canonical SMILES for 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one is O=C1CCc2ccc(OCCCF)cc21.
What is the InChIKey of 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one?
The InChIKey is HAHGCXCELXOBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO2/c13-6-1-7-15-10-4-2-9-3-5-12(14)11(9)8-10/h2,4,8H,1,3,5-7H2.
What are the key properties of 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one?
6-(3-fluoropropoxy)-2,3-dihydroinden-1-one has a molecular weight of 208.23 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-fluoropropoxy)-2,3-dihydroinden-1-one is sourced from PubChem (CID 67979471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).