About 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine
6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine (PubChem CID 67979513) has the molecular formula C14H14BrF2N
and a molecular weight of 314.17 g/mol. Its IUPAC name is 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine.
Molecular Properties
| Compound Name | 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine |
| PubChem CID | 67979513 |
| Molecular Formula | C14H14BrF2N |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine |
| SMILES | [H]/N=C1\c2cc(Br)ccc2CC12CCC(F)(F)CC2 |
| InChI | InChI=1S/C14H14BrF2N/c15-10-2-1-9-8-13(12(18)11(9)7-10)3-5-14(16,17)6-4-13/h1-2,7,18H,3-6,8H2/b18-12+ |
| InChIKey | CBROKOMMBXPWHL-LDADJPATSA-N |
| XLogP | 4.57 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine?
The IUPAC name of 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine (CID 67979513) is 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine.
What is the SMILES notation for 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine?
The canonical SMILES for 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine is [H]/N=C1\c2cc(Br)ccc2CC12CCC(F)(F)CC2.
What is the InChIKey of 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine?
The InChIKey is CBROKOMMBXPWHL-LDADJPATSA-N. The full InChI is InChI=1S/C14H14BrF2N/c15-10-2-1-9-8-13(12(18)11(9)7-10)3-5-14(16,17)6-4-13/h1-2,7,18H,3-6,8H2/b18-12+.
What are the key properties of 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine?
6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine has a molecular weight of 314.17 g/mol, XLogP of 4.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4',4'-difluorospiro[3H-indene-2,1'-cyclohexane]-1-imine is sourced from PubChem (CID 67979513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).