C16H17N9 — CID 67979634
5-[1-(4-amino-6-methyl-1,3,5-triazin-2-yl)benzimidazol-2-yl]-2H-pyridine-2,5-diamine (PubChem CID 67979634) has the molecular formula C16H17N9 and a molecular weight of 335.38 g/mol. Its IUPAC name is 5-[1-(4-amino-6-methyl-1,3,5-triazin-2-yl)benzimidazol-2-yl]-2H-pyridine-2,5-diamine.
| Compound Name | 5-[1-(4-amino-6-methyl-1,3,5-triazin-2-yl)benzimidazol-2-yl]-2H-pyridine-2,5-diamine |
|---|---|
| PubChem CID | 67979634 |
| Molecular Formula | C16H17N9 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 5-[1-(4-amino-6-methyl-1,3,5-triazin-2-yl)benzimidazol-2-yl]-2H-pyridine-2,5-diamine |
| SMILES | Cc1nc(N)nc(-n2c(C3(N)C=CC(N)N=C3)nc3ccccc32)n1 |
| InChI | InChI=1S/C16H17N9/c1-9-21-14(18)24-15(22-9)25-11-5-3-2-4-10(11)23-13(25)16(19)7-6-12(17)20-8-16/h2-8,12H,17,19H2,1H3,(H2,18,21,22,24) |
| InChIKey | BHBQGBLSQLVMRJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 146.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|