C15H38N2O2Si3 — CID 67979904
3-(2,6-dimethyl-1,3,6,2-dioxazasilocan-2-yl)-N,N-bis(trimethylsilyl)propan-1-amine (PubChem CID 67979904) has the molecular formula C15H38N2O2Si3 and a molecular weight of 362.74 g/mol. Its IUPAC name is 3-(2,6-dimethyl-1,3,6,2-dioxazasilocan-2-yl)-N,N-bis(trimethylsilyl)propan-1-amine.
| Compound Name | 3-(2,6-dimethyl-1,3,6,2-dioxazasilocan-2-yl)-N,N-bis(trimethylsilyl)propan-1-amine |
|---|---|
| PubChem CID | 67979904 |
| Molecular Formula | C15H38N2O2Si3 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 3-(2,6-dimethyl-1,3,6,2-dioxazasilocan-2-yl)-N,N-bis(trimethylsilyl)propan-1-amine |
| SMILES | CN1CCO[Si](C)(CCCN([Si](C)(C)C)[Si](C)(C)C)OCC1 |
| InChI | InChI=1S/C15H38N2O2Si3/c1-16-11-13-18-22(8,19-14-12-16)15-9-10-17(20(2,3)4)21(5,6)7/h9-15H2,1-8H3 |
| InChIKey | CNMIAICUTJPZOU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|