C13H13I3N2O4 — CID 6798
2,4,6-triiodo-3,5-bis(propanoylamino)benzoic acid (PubChem CID 6798) has the molecular formula C13H13I3N2O4 and a molecular weight of 641.97 g/mol. Its IUPAC name is 2,4,6-triiodo-3,5-bis(propanoylamino)benzoic acid.
| Compound Name | 2,4,6-triiodo-3,5-bis(propanoylamino)benzoic acid |
|---|---|
| PubChem CID | 6798 |
| Molecular Formula | C13H13I3N2O4 |
| Molecular Weight | 641.97 g/mol |
| Exact Mass | 641.80 |
| IUPAC Name | 2,4,6-triiodo-3,5-bis(propanoylamino)benzoic acid |
| SMILES | CCC(=O)Nc1c(I)c(NC(=O)CC)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C13H13I3N2O4/c1-3-5(19)17-11-8(14)7(13(21)22)9(15)12(10(11)16)18-6(20)4-2/h3-4H2,1-2H3,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | OIXRDAZPDINJPT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.97 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|