C30H23N3O3 — CID 67980098
3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(6-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 67980098) has the molecular formula C30H23N3O3 and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(6-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(6-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67980098 |
| Molecular Formula | C30H23N3O3 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(6-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn3c4c(cccc24)CCC3)=C1c1c[nH]c2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C30H23N3O3/c34-29-26(23-15-31-25-14-20(11-12-21(23)25)36-17-18-6-2-1-3-7-18)27(30(35)32-29)24-16-33-13-5-9-19-8-4-10-22(24)28(19)33/h1-4,6-8,10-12,14-16,31H,5,9,13,17H2,(H,32,34,35) |
| InChIKey | SCNCBMZHXKQVNS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|