C14H32N2O2Si2 — CID 67980129
N-cyclopentyl-2,6-dimethyl-N-trimethylsilyl-1,3,6,2-dioxazasilocan-2-amine (PubChem CID 67980129) has the molecular formula C14H32N2O2Si2 and a molecular weight of 316.59 g/mol. Its IUPAC name is N-cyclopentyl-2,6-dimethyl-N-trimethylsilyl-1,3,6,2-dioxazasilocan-2-amine.
| Compound Name | N-cyclopentyl-2,6-dimethyl-N-trimethylsilyl-1,3,6,2-dioxazasilocan-2-amine |
|---|---|
| PubChem CID | 67980129 |
| Molecular Formula | C14H32N2O2Si2 |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N-cyclopentyl-2,6-dimethyl-N-trimethylsilyl-1,3,6,2-dioxazasilocan-2-amine |
| SMILES | CN1CCO[Si](C)(N(C2CCCC2)[Si](C)(C)C)OCC1 |
| InChI | InChI=1S/C14H32N2O2Si2/c1-15-10-12-17-20(5,18-13-11-15)16(19(2,3)4)14-8-6-7-9-14/h14H,6-13H2,1-5H3 |
| InChIKey | SBUFUHBBBOWFCS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|