C17H24O2 — CID 67980476
2-[4-(2-cyclohexylethyl)phenyl]-1,3-dioxolane (PubChem CID 67980476) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-[4-(2-cyclohexylethyl)phenyl]-1,3-dioxolane.
| Compound Name | 2-[4-(2-cyclohexylethyl)phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 67980476 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2-[4-(2-cyclohexylethyl)phenyl]-1,3-dioxolane |
| SMILES | c1cc(C2OCCO2)ccc1CCC1CCCCC1 |
| InChI | InChI=1S/C17H24O2/c1-2-4-14(5-3-1)6-7-15-8-10-16(11-9-15)17-18-12-13-19-17/h8-11,14,17H,1-7,12-13H2 |
| InChIKey | VIUMUTCUCWFJRK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |