C28H58OSi2 — CID 67980673
10,10,13,13-tetraethyl-12-oxa-11,13-disilaspiro[10.12]tricosane (PubChem CID 67980673) has the molecular formula C28H58OSi2 and a molecular weight of 466.94 g/mol. Its IUPAC name is 10,10,13,13-tetraethyl-12-oxa-11,13-disilaspiro[10.12]tricosane.
| Compound Name | 10,10,13,13-tetraethyl-12-oxa-11,13-disilaspiro[10.12]tricosane |
|---|---|
| PubChem CID | 67980673 |
| Molecular Formula | C28H58OSi2 |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.40 |
| IUPAC Name | 10,10,13,13-tetraethyl-12-oxa-11,13-disilaspiro[10.12]tricosane |
| SMILES | CCC1(CC)CCCCCCCCC[Si]12CCCCCCCCCC[Si](CC)(CC)O2 |
| InChI | InChI=1S/C28H58OSi2/c1-5-28(6-2)24-20-16-12-11-15-19-23-27-31(28)26-22-18-14-10-9-13-17-21-25-30(7-3,8-4)29-31/h5-27H2,1-4H3 |
| InChIKey | QJYBYTAGLWYGBB-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|