About 8aH-1,3-benzodioxine
8aH-1,3-benzodioxine (PubChem CID 67980753) has the molecular formula C8H8O2
and a molecular weight of 136.15 g/mol. Its IUPAC name is 8aH-1,3-benzodioxine.
Molecular Properties
| Compound Name | 8aH-1,3-benzodioxine |
| PubChem CID | 67980753 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 8aH-1,3-benzodioxine |
| SMILES | C1=CC2=COCOC2C=C1 |
| InChI | InChI=1S/C8H8O2/c1-2-4-8-7(3-1)5-9-6-10-8/h1-5,8H,6H2 |
| InChIKey | AWEIFOVIFPDFAN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8aH-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8aH-1,3-benzodioxine?
The IUPAC name of 8aH-1,3-benzodioxine (CID 67980753) is 8aH-1,3-benzodioxine.
What is the SMILES notation for 8aH-1,3-benzodioxine?
The canonical SMILES for 8aH-1,3-benzodioxine is C1=CC2=COCOC2C=C1.
What is the InChIKey of 8aH-1,3-benzodioxine?
The InChIKey is AWEIFOVIFPDFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2/c1-2-4-8-7(3-1)5-9-6-10-8/h1-5,8H,6H2.
What are the key properties of 8aH-1,3-benzodioxine?
8aH-1,3-benzodioxine has a molecular weight of 136.15 g/mol, XLogP of 1.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8aH-1,3-benzodioxine is sourced from PubChem (CID 67980753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).