C18H18F3N — CID 67981332
2-cyclopropyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethanamine (PubChem CID 67981332) has the molecular formula C18H18F3N and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-cyclopropyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethanamine.
| Compound Name | 2-cyclopropyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethanamine |
|---|---|
| PubChem CID | 67981332 |
| Molecular Formula | C18H18F3N |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-cyclopropyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethanamine |
| SMILES | NC(CC1CC1)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H18F3N/c19-18(20,21)16-9-7-14(8-10-16)13-3-5-15(6-4-13)17(22)11-12-1-2-12/h3-10,12,17H,1-2,11,22H2 |
| InChIKey | NYNYKDVBUNAWNJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |