About 2,4,5-triaminobenzenethiol
2,4,5-triaminobenzenethiol (PubChem CID 67981805) has the molecular formula C6H9N3S
and a molecular weight of 155.23 g/mol. Its IUPAC name is 2,4,5-triaminobenzenethiol.
Molecular Properties
| Compound Name | 2,4,5-triaminobenzenethiol |
| PubChem CID | 67981805 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 2,4,5-triaminobenzenethiol |
| SMILES | Nc1cc(N)c(S)cc1N |
| InChI | InChI=1S/C6H9N3S/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H,7-9H2 |
| InChIKey | JDEGCXMFBGPEGS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5-triaminobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-triaminobenzenethiol?
The IUPAC name of 2,4,5-triaminobenzenethiol (CID 67981805) is 2,4,5-triaminobenzenethiol.
What is the SMILES notation for 2,4,5-triaminobenzenethiol?
The canonical SMILES for 2,4,5-triaminobenzenethiol is Nc1cc(N)c(S)cc1N.
What is the InChIKey of 2,4,5-triaminobenzenethiol?
The InChIKey is JDEGCXMFBGPEGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3S/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H,7-9H2.
What are the key properties of 2,4,5-triaminobenzenethiol?
2,4,5-triaminobenzenethiol has a molecular weight of 155.23 g/mol, XLogP of 0.72, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-triaminobenzenethiol is sourced from PubChem (CID 67981805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).