C14H20BF3N2O5S — CID 67982093
2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide (PubChem CID 67982093) has the molecular formula C14H20BF3N2O5S and a molecular weight of 396.20 g/mol. Its IUPAC name is 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide.
| Compound Name | 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 67982093 |
| Molecular Formula | C14H20BF3N2O5S |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
| SMILES | COc1ncc(B2OC(C)(C)C(C)(C)O2)cc1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C14H20BF3N2O5S/c1-12(2)13(3,4)25-15(24-12)9-6-10(11(23-5)19-7-9)26(21,22)20-8-14(16,17)18/h6-7,20H,8H2,1-5H3 |
| InChIKey | XGVZQPCOEZDZKR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|