About 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one
2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one (PubChem CID 67982499) has the molecular formula C21H18N4O3
and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one.
Molecular Properties
| Compound Name | 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one |
| PubChem CID | 67982499 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one |
| SMILES | COc1cc(-c2ccc3nc(N)n(-c4ccccc4)c(=O)c3c2)cnc1OC |
| InChI | InChI=1S/C21H18N4O3/c1-27-18-11-14(12-23-19(18)28-2)13-8-9-17-16(10-13)20(26)25(21(22)24-17)15-6-4-3-5-7-15/h3-12H,1-2H3,(H2,22,24) |
| InChIKey | AEWQVMNZHZEGMP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one?
The IUPAC name of 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one (CID 67982499) is 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one.
What is the SMILES notation for 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one?
The canonical SMILES for 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one is COc1cc(-c2ccc3nc(N)n(-c4ccccc4)c(=O)c3c2)cnc1OC.
What is the InChIKey of 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one?
The InChIKey is AEWQVMNZHZEGMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O3/c1-27-18-11-14(12-23-19(18)28-2)13-8-9-17-16(10-13)20(26)25(21(22)24-17)15-6-4-3-5-7-15/h3-12H,1-2H3,(H2,22,24).
What are the key properties of 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one?
2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one has a molecular weight of 374.40 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(5,6-dimethoxy-3-pyridinyl)-3-phenylquinazolin-4-one is sourced from PubChem (CID 67982499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).